9,9-Di(p-tolyl)-fluoren-2-yl]boronic acid - Names and Identifiers
Name | [9,9-Bis(4-methylphenyl)-9H-fluoren-2-yl]boronic acid
|
Synonyms | 2-BATolF 9,9-Di(p-tolyl)fluorene-2-boronic Acid 9,9-Di(p-tolyl)-fluoren-2-yl]boronic acid (9,9-Di-p-tolyl-9H-fluoren-2-yl)boronic acid B-[9,9-Bis(4-methylphenyl)-9H-fluoren-2-yl]boron [9,9-bis(4-methylphenyl)fluoren-2-yl]boronic acid [9,9-Bis(4-methylphenyl)-9H-fluoren-2-yl]boronic acid B-[9,9-Bis(4-methylphenyl)-9H-fluoren-2-yl]boronic acid Boronic acid, B-[9,9-bis(4-methylphenyl)-9H-fluoren-2-yl]- 9,9-Di(p-tolyl)fluorene-2-boronic Acid (contains varying amounts of Anhydride)
|
CAS | 1193104-83-4
|
InChI | InChI=1S/C27H23BO2/c1-18-7-11-20(12-8-18)27(21-13-9-19(2)10-14-21)25-6-4-3-5-23(25)24-16-15-22(28(29)30)17-26(24)27/h3-17,29-30H,1-2H3 |
9,9-Di(p-tolyl)-fluoren-2-yl]boronic acid - Physico-chemical Properties
Molecular Formula | C27H23BO2
|
Molar Mass | 390.28 |
Density | 1.24 |
Boling Point | 570.1±60.0 °C(Predicted) |
Appearance | powder to crystal |
Color | White to Almost white |
pKa | 8.56±0.40(Predicted) |
Storage Condition | 2-8°C |
9,9-Di(p-tolyl)-fluoren-2-yl]boronic acid - Introduction
B- [9,9-bis (4-methylphenyl)-9H-fluoren-2-yl] boronic acid is an organoboron compound with the following properties:
1. Appearance: B- [9,9-bis (4-methylphenyl)-9H-fluoren-2-yl] boronic acid is a white crystalline solid.
2. Melting point: Its melting point is about 150-155 degrees Celsius.
3. Solubility: It is soluble in some organic solvents, such as dimethyl sulfoxide and dichloromethane.
4. Stability: B- [9,9-bis (4-methylphenyl)-9H-fluoren-2-yl] boronic acid is stable at room temperature and is not easy to decompose under dry conditions.
The main uses of B- [9,9-bis (4-methylphenyl)-9H-fluoren-2-yl] boronic acid are as follows:
1. Organic light-emitting diode (OLED) material: It has good light-emitting properties and can be used as a light-emitting layer material for OLED devices.
2. Photoelectric material: Due to its fluorene structure, it can also be used to prepare solar cells and other optoelectronic devices.
3. Catalyst: It can be used as a catalyst for certain organic reactions, such as the Huifman degradation reaction.
As for the preparation method, B- [9,9-bis (4-methylphenyl)-9H-fluoren-2-yl] boronic acid is generally obtained by synthetic chemical methods, and the specific preparation route varies with different experimental conditions and requirements.
In terms of safety, B- [9,9-bis (4-methylphenyl)-9H-fluoren-2-yl] boronic acid has no special safety risk report, but as a chemical substance, it is still recommended to pay attention to the following matters during use and storage:
1. safe operation: avoid direct contact with skin and eyes, avoid inhalation or intake. Appropriate protective equipment such as gloves and goggles should be worn.
2. storage note: should be stored in a dry, ventilated and dark place, away from combustibles and oxidants.
3. waste treatment: in accordance with local environmental standards for treatment, do not arbitrarily poured into the sewer or trash.
4. refer to the relevant literature and safety data sheets before use for more detailed safety information.
Last Update:2024-04-09 21:21:28